C16H14ClNO2S — CID 52784611
2-chloro-N-(furan-2-ylmethyl)-5-methylsulfanyl-N-prop-2-ynylbenzamide (PubChem CID 52784611) has the molecular formula C16H14ClNO2S and a molecular weight of 319.81 g/mol. Its IUPAC name is 2-chloro-N-(furan-2-ylmethyl)-5-methylsulfanyl-N-prop-2-ynylbenzamide.
| Compound Name | 2-chloro-N-(furan-2-ylmethyl)-5-methylsulfanyl-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 52784611 |
| Molecular Formula | C16H14ClNO2S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-chloro-N-(furan-2-ylmethyl)-5-methylsulfanyl-N-prop-2-ynylbenzamide |
| SMILES | C#CCN(Cc1ccco1)C(=O)c1cc(SC)ccc1Cl |
| InChI | InChI=1S/C16H14ClNO2S/c1-3-8-18(11-12-5-4-9-20-12)16(19)14-10-13(21-2)6-7-15(14)17/h1,4-7,9-10H,8,11H2,2H3 |
| InChIKey | RZFLCZNEXHFQMQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|