C17H22N4OS — CID 52910555
(5S)-5-methyl-N-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 52910555) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is (5S)-5-methyl-N-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5S)-5-methyl-N-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 52910555 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (5S)-5-methyl-N-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1nnc2n1C[C@@H](NC(=O)c1cc3c(s1)CC[C@H](C)C3)CC2 |
| InChI | InChI=1S/C17H22N4OS/c1-10-3-5-14-12(7-10)8-15(23-14)17(22)18-13-4-6-16-20-19-11(2)21(16)9-13/h8,10,13H,3-7,9H2,1-2H3,(H,18,22)/t10-,13-/m0/s1 |
| InChIKey | HDZOCHVROUUJFO-GWCFXTLKSA-N |
| XLogP | 2.52 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |