C30H40N8O4 — CID 52948660
3-[[4-[2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methyl]-5-(2-hydroxypropan-2-yl)-N-(6-nitrohexyl)-2-propylimidazole-4-carboxamide (PubChem CID 52948660) has the molecular formula C30H40N8O4 and a molecular weight of 576.70 g/mol. Its IUPAC name is 3-[[4-[2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methyl]-5-(2-hydroxypropan-2-yl)-N-(6-nitrohexyl)-2-propylimidazole-4-carboxamide.
| Compound Name | 3-[[4-[2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methyl]-5-(2-hydroxypropan-2-yl)-N-(6-nitrohexyl)-2-propylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 52948660 |
| Molecular Formula | C30H40N8O4 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | 3-[[4-[2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methyl]-5-(2-hydroxypropan-2-yl)-N-(6-nitrohexyl)-2-propylimidazole-4-carboxamide |
| SMILES | CCCc1nc(C(C)(C)O)c(C(=O)NCCCCCC[N+](=O)[O-])n1Cc1ccc(-c2ccccc2C2=NNNN2)cc1 |
| InChI | InChI=1S/C30H40N8O4/c1-4-11-25-32-27(30(2,3)40)26(29(39)31-18-9-5-6-10-19-38(41)42)37(25)20-21-14-16-22(17-15-21)23-12-7-8-13-24(23)28-33-35-36-34-28/h7-8,12-17,35-36,40H,4-6,9-11,18-20H2,1-3H3,(H,31,39)(H,33,34) |
| InChIKey | MDIMOQWCVYFJMS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 158.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|