C39H76O6Si2 — CID 52951214
methyl (3S,4S,5S,8S,10S,11S,12E,14S)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-4,6,6,8,10,12,14,16-octamethyl-7-oxoheptadeca-12,15-dienoate (PubChem CID 52951214) has the molecular formula C39H76O6Si2 and a molecular weight of 697.20 g/mol. Its IUPAC name is methyl (3S,4S,5S,8S,10S,11S,12E,14S)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-4,6,6,8,10,12,14,16-octamethyl-7-oxoheptadeca-12,15-dienoate.
| Compound Name | methyl (3S,4S,5S,8S,10S,11S,12E,14S)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-4,6,6,8,10,12,14,16-octamethyl-7-oxoheptadeca-12,15-dienoate |
|---|---|
| PubChem CID | 52951214 |
| Molecular Formula | C39H76O6Si2 |
| Molecular Weight | 697.20 g/mol |
| Exact Mass | 696.52 |
| IUPAC Name | methyl (3S,4S,5S,8S,10S,11S,12E,14S)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-4,6,6,8,10,12,14,16-octamethyl-7-oxoheptadeca-12,15-dienoate |
| SMILES | COC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](OC)C(C)(C)C(=O)[C@@H](C)C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@@H](C)C=C(C)C |
| InChI | InChI=1S/C39H76O6Si2/c1-26(2)22-27(3)23-28(4)34(45-47(20,21)38(11,12)13)29(5)24-30(6)35(41)39(14,15)36(43-17)31(7)32(25-33(40)42-16)44-46(18,19)37(8,9)10/h22-23,27,29-32,34,36H,24-25H2,1-21H3/b28-23+/t27-,29-,30-,31+,32-,34+,36-/m0/s1 |
| InChIKey | CTNSOOUSPZFONL-HAGBMZJHSA-N |
| XLogP | 10.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.20 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|