C14H14ClN — CID 52982839
(E)-N-chloro-3-(2-phenylethyl)cyclohexa-2,4-dien-1-imine (PubChem CID 52982839) has the molecular formula C14H14ClN and a molecular weight of 231.73 g/mol. Its IUPAC name is (E)-N-chloro-3-(2-phenylethyl)cyclohexa-2,4-dien-1-imine.
| Compound Name | (E)-N-chloro-3-(2-phenylethyl)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 52982839 |
| Molecular Formula | C14H14ClN |
| Molecular Weight | 231.73 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | (E)-N-chloro-3-(2-phenylethyl)cyclohexa-2,4-dien-1-imine |
| SMILES | Cl/N=C1/C=C(CCc2ccccc2)C=CC1 |
| InChI | InChI=1S/C14H14ClN/c15-16-14-8-4-7-13(11-14)10-9-12-5-2-1-3-6-12/h1-7,11H,8-10H2/b16-14+ |
| InChIKey | QLZQASIXNPIYQV-JQIJEIRASA-N |
| XLogP | 4.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.73 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|