C17H11N5O4 — CID 5299785
1-[4-(1,3-dioxoisoindol-2-yl)-1,2,5-oxadiazol-3-yl]-3-phenylurea (PubChem CID 5299785) has the molecular formula C17H11N5O4 and a molecular weight of 349.31 g/mol. Its IUPAC name is 1-[4-(1,3-dioxoisoindol-2-yl)-1,2,5-oxadiazol-3-yl]-3-phenylurea.
| Compound Name | 1-[4-(1,3-dioxoisoindol-2-yl)-1,2,5-oxadiazol-3-yl]-3-phenylurea |
|---|---|
| PubChem CID | 5299785 |
| Molecular Formula | C17H11N5O4 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 1-[4-(1,3-dioxoisoindol-2-yl)-1,2,5-oxadiazol-3-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1nonc1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H11N5O4/c23-15-11-8-4-5-9-12(11)16(24)22(15)14-13(20-26-21-14)19-17(25)18-10-6-2-1-3-7-10/h1-9H,(H2,18,19,20,25) |
| InChIKey | HYALGGKJJPUCMG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|