C17H9ClN4O4 — CID 5302332
2-chloro-N-[4-(1,3-dioxoisoindol-2-yl)-1,2,5-oxadiazol-3-yl]benzamide (PubChem CID 5302332) has the molecular formula C17H9ClN4O4 and a molecular weight of 368.74 g/mol. Its IUPAC name is 2-chloro-N-[4-(1,3-dioxoisoindol-2-yl)-1,2,5-oxadiazol-3-yl]benzamide.
| Compound Name | 2-chloro-N-[4-(1,3-dioxoisoindol-2-yl)-1,2,5-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 5302332 |
| Molecular Formula | C17H9ClN4O4 |
| Molecular Weight | 368.74 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 2-chloro-N-[4-(1,3-dioxoisoindol-2-yl)-1,2,5-oxadiazol-3-yl]benzamide |
| SMILES | O=C(Nc1nonc1N1C(=O)c2ccccc2C1=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H9ClN4O4/c18-12-8-4-3-7-11(12)15(23)19-13-14(21-26-20-13)22-16(24)9-5-1-2-6-10(9)17(22)25/h1-8H,(H,19,20,23) |
| InChIKey | VUJXPPAVBGXTLO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.74 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|