C21H24N2OS — CID 53002123
4-(4-methylphenyl)-N-pentyl-3-pyrrol-1-ylthiophene-2-carboxamide (PubChem CID 53002123) has the molecular formula C21H24N2OS and a molecular weight of 352.50 g/mol. Its IUPAC name is 4-(4-methylphenyl)-N-pentyl-3-pyrrol-1-ylthiophene-2-carboxamide.
| Compound Name | 4-(4-methylphenyl)-N-pentyl-3-pyrrol-1-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 53002123 |
| Molecular Formula | C21H24N2OS |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 4-(4-methylphenyl)-N-pentyl-3-pyrrol-1-ylthiophene-2-carboxamide |
| SMILES | CCCCCNC(=O)c1scc(-c2ccc(C)cc2)c1-n1cccc1 |
| InChI | InChI=1S/C21H24N2OS/c1-3-4-5-12-22-21(24)20-19(23-13-6-7-14-23)18(15-25-20)17-10-8-16(2)9-11-17/h6-11,13-15H,3-5,12H2,1-2H3,(H,22,24) |
| InChIKey | DMHUXHCDAISBSV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|