C22H23ClN4O3 — CID 53086644
ethyl 3-(2-chlorophenyl)-4-[2-(cyclohexen-1-yl)ethylamino]-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate (PubChem CID 53086644) has the molecular formula C22H23ClN4O3 and a molecular weight of 426.90 g/mol. Its IUPAC name is ethyl 3-(2-chlorophenyl)-4-[2-(cyclohexen-1-yl)ethylamino]-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 3-(2-chlorophenyl)-4-[2-(cyclohexen-1-yl)ethylamino]-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 53086644 |
| Molecular Formula | C22H23ClN4O3 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | ethyl 3-(2-chlorophenyl)-4-[2-(cyclohexen-1-yl)ethylamino]-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1nc(NCCC2=CCCCC2)c2c(-c3ccccc3Cl)noc2n1 |
| InChI | InChI=1S/C22H23ClN4O3/c1-2-29-22(28)20-25-19(24-13-12-14-8-4-3-5-9-14)17-18(27-30-21(17)26-20)15-10-6-7-11-16(15)23/h6-8,10-11H,2-5,9,12-13H2,1H3,(H,24,25,26) |
| InChIKey | DYLUUKXNZZEMFK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|