C11H9NOS3 — CID 5310740
(4Z)-2-methylsulfanyl-4-[(E)-3-thiophen-2-ylprop-2-enylidene]-1,3-thiazol-5-one (PubChem CID 5310740) has the molecular formula C11H9NOS3 and a molecular weight of 267.40 g/mol. Its IUPAC name is (4Z)-2-methylsulfanyl-4-[(E)-3-thiophen-2-ylprop-2-enylidene]-1,3-thiazol-5-one.
| Compound Name | (4Z)-2-methylsulfanyl-4-[(E)-3-thiophen-2-ylprop-2-enylidene]-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 5310740 |
| Molecular Formula | C11H9NOS3 |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 266.98 |
| IUPAC Name | (4Z)-2-methylsulfanyl-4-[(E)-3-thiophen-2-ylprop-2-enylidene]-1,3-thiazol-5-one |
| SMILES | CSC1=N/C(=C\C=C\c2cccs2)C(=O)S1 |
| InChI | InChI=1S/C11H9NOS3/c1-14-11-12-9(10(13)16-11)6-2-4-8-5-3-7-15-8/h2-7H,1H3/b4-2+,9-6- |
| InChIKey | MYVZLCKDZMGVKR-RXXVAJQJSA-N |
| XLogP | 3.64 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|