C15H13NOS2 — CID 2923217
4-cinnamylidene-2-prop-2-enylsulfanyl-1,3-thiazol-5-one (PubChem CID 2923217) has the molecular formula C15H13NOS2 and a molecular weight of 287.41 g/mol. Its IUPAC name is 4-cinnamylidene-2-prop-2-enylsulfanyl-1,3-thiazol-5-one.
| Compound Name | 4-cinnamylidene-2-prop-2-enylsulfanyl-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 2923217 |
| Molecular Formula | C15H13NOS2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 4-cinnamylidene-2-prop-2-enylsulfanyl-1,3-thiazol-5-one |
| SMILES | C=CCSC1=NC(=CC=Cc2ccccc2)C(=O)S1 |
| InChI | InChI=1S/C15H13NOS2/c1-2-11-18-15-16-13(14(17)19-15)10-6-9-12-7-4-3-5-8-12/h2-10H,1,11H2 |
| InChIKey | XUCNXWJKNQBTDV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|