C23H26ClN3O3 — CID 53146106
N-[(4-chlorophenyl)methyl]-4-(cyclobutanecarbonylamino)-2-morpholin-4-ylbenzamide (PubChem CID 53146106) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4-(cyclobutanecarbonylamino)-2-morpholin-4-ylbenzamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-4-(cyclobutanecarbonylamino)-2-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 53146106 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4-(cyclobutanecarbonylamino)-2-morpholin-4-ylbenzamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1ccc(NC(=O)C2CCC2)cc1N1CCOCC1 |
| InChI | InChI=1S/C23H26ClN3O3/c24-18-6-4-16(5-7-18)15-25-23(29)20-9-8-19(26-22(28)17-2-1-3-17)14-21(20)27-10-12-30-13-11-27/h4-9,14,17H,1-3,10-13,15H2,(H,25,29)(H,26,28) |
| InChIKey | FKDGEKKCAZDNFO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |