C23H26ClN3S — CID 53206744
3-(2-chloro-4-methylphenyl)-1-cyclohexyl-1-(1H-indol-3-ylmethyl)thiourea (PubChem CID 53206744) has the molecular formula C23H26ClN3S and a molecular weight of 412.00 g/mol. Its IUPAC name is 3-(2-chloro-4-methylphenyl)-1-cyclohexyl-1-(1H-indol-3-ylmethyl)thiourea.
| Compound Name | 3-(2-chloro-4-methylphenyl)-1-cyclohexyl-1-(1H-indol-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 53206744 |
| Molecular Formula | C23H26ClN3S |
| Molecular Weight | 412.00 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 3-(2-chloro-4-methylphenyl)-1-cyclohexyl-1-(1H-indol-3-ylmethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(Cc2c[nH]c3ccccc23)C2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C23H26ClN3S/c1-16-11-12-22(20(24)13-16)26-23(28)27(18-7-3-2-4-8-18)15-17-14-25-21-10-6-5-9-19(17)21/h5-6,9-14,18,25H,2-4,7-8,15H2,1H3,(H,26,28) |
| InChIKey | XWECEYBKIMWCJI-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.00 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|