C16H24Br2N4OSi — CID 53239247
2-[[2,3-dibromo-5-(4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridin-4-yl)pyrrol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 53239247) has the molecular formula C16H24Br2N4OSi and a molecular weight of 476.29 g/mol. Its IUPAC name is 2-[[2,3-dibromo-5-(4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridin-4-yl)pyrrol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2,3-dibromo-5-(4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridin-4-yl)pyrrol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 53239247 |
| Molecular Formula | C16H24Br2N4OSi |
| Molecular Weight | 476.29 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | 2-[[2,3-dibromo-5-(4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridin-4-yl)pyrrol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(C2NCCc3[nH]cnc32)cc(Br)c1Br |
| InChI | InChI=1S/C16H24Br2N4OSi/c1-24(2,3)7-6-23-10-22-13(8-11(17)16(22)18)15-14-12(4-5-19-15)20-9-21-14/h8-9,15,19H,4-7,10H2,1-3H3,(H,20,21) |
| InChIKey | BCNYMKQZTCMZQZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 54.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|