C20H12N4O3S — CID 5325416
4-[(6-nitro-1,3-benzothiazol-2-yl)amino]-10H-acridin-9-one (PubChem CID 5325416) has the molecular formula C20H12N4O3S and a molecular weight of 388.41 g/mol. Its IUPAC name is 4-[(6-nitro-1,3-benzothiazol-2-yl)amino]-10H-acridin-9-one.
| Compound Name | 4-[(6-nitro-1,3-benzothiazol-2-yl)amino]-10H-acridin-9-one |
|---|---|
| PubChem CID | 5325416 |
| Molecular Formula | C20H12N4O3S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 4-[(6-nitro-1,3-benzothiazol-2-yl)amino]-10H-acridin-9-one |
| SMILES | O=c1c2ccccc2[nH]c2c(Nc3nc4ccc([N+](=O)[O-])cc4s3)cccc12 |
| InChI | InChI=1S/C20H12N4O3S/c25-19-12-4-1-2-6-14(12)21-18-13(19)5-3-7-16(18)23-20-22-15-9-8-11(24(26)27)10-17(15)28-20/h1-10H,(H,21,25)(H,22,23) |
| InChIKey | LXWJOLSUKLDIPF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|