C13H16O2S2 — CID 53260357
1-(1,3-dithiolan-2-ylidene)-1-(4-methoxyphenyl)propan-2-ol (PubChem CID 53260357) has the molecular formula C13H16O2S2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-(1,3-dithiolan-2-ylidene)-1-(4-methoxyphenyl)propan-2-ol.
| Compound Name | 1-(1,3-dithiolan-2-ylidene)-1-(4-methoxyphenyl)propan-2-ol |
|---|---|
| PubChem CID | 53260357 |
| Molecular Formula | C13H16O2S2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1-(1,3-dithiolan-2-ylidene)-1-(4-methoxyphenyl)propan-2-ol |
| SMILES | COc1ccc(C(=C2SCCS2)C(C)O)cc1 |
| InChI | InChI=1S/C13H16O2S2/c1-9(14)12(13-16-7-8-17-13)10-3-5-11(15-2)6-4-10/h3-6,9,14H,7-8H2,1-2H3 |
| InChIKey | RVYYCMOIDWIDMF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |