C19H21NO5S — CID 53270605
2-[5-(3-butoxycarbonylphenyl)furan-2-yl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 53270605) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-[5-(3-butoxycarbonylphenyl)furan-2-yl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-[5-(3-butoxycarbonylphenyl)furan-2-yl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 53270605 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 2-[5-(3-butoxycarbonylphenyl)furan-2-yl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCCCOC(=O)c1cccc(-c2ccc(C3NC(C(=O)O)CS3)o2)c1 |
| InChI | InChI=1S/C19H21NO5S/c1-2-3-9-24-19(23)13-6-4-5-12(10-13)15-7-8-16(25-15)17-20-14(11-26-17)18(21)22/h4-8,10,14,17,20H,2-3,9,11H2,1H3,(H,21,22) |
| InChIKey | TUOMUYSHNSOAES-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|