C34H40N4O4 — CID 5327183
3-[(5Z,7E,10Z,15Z,19Z)-18-(2-carboxyethyl)-12-ethenyl-7-ethylidene-3,8,13,17-tetramethyl-4,14,21,22,23,24-hexahydro-3H-porphyrin-2-yl]propanoic acid (PubChem CID 5327183) has the molecular formula C34H40N4O4 and a molecular weight of 568.72 g/mol. Its IUPAC name is 3-[(5Z,7E,10Z,15Z,19Z)-18-(2-carboxyethyl)-12-ethenyl-7-ethylidene-3,8,13,17-tetramethyl-4,14,21,22,23,24-hexahydro-3H-porphyrin-2-yl]propanoic acid.
| Compound Name | 3-[(5Z,7E,10Z,15Z,19Z)-18-(2-carboxyethyl)-12-ethenyl-7-ethylidene-3,8,13,17-tetramethyl-4,14,21,22,23,24-hexahydro-3H-porphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 5327183 |
| Molecular Formula | C34H40N4O4 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 3-[(5Z,7E,10Z,15Z,19Z)-18-(2-carboxyethyl)-12-ethenyl-7-ethylidene-3,8,13,17-tetramethyl-4,14,21,22,23,24-hexahydro-3H-porphyrin-2-yl]propanoic acid |
| SMILES | C=CC1=C(C)C2/C=c3\[nH]/c(c(CCC(=O)O)c3C)=C\C3=C(CCC(=O)O)C(C)C(/C=c4\[nH]c(c(C)\c4=C/C)/C=C/1N2)N3 |
| InChI | InChI=1S/C34H40N4O4/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25/h7-8,13-16,20,25,28,35-38H,1,9-12H2,2-6H3,(H,39,40)(H,41,42)/b22-8+,26-13-,29-14-,30-15-,31-16- |
| InChIKey | QIHSCFVOYYLIHX-WWPMANJKSA-N |
| XLogP | 2.37 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |