C26H24N6O4S — CID 53295000
(1E)-N-(3-morpholin-4-yloxadiazol-3-ium-5-yl)-2-[(4E)-5-oxo-1-phenyl-4-[(E)-3-phenylprop-2-enylidene]imidazol-2-yl]sulfanylethanimidate (PubChem CID 53295000) has the molecular formula C26H24N6O4S and a molecular weight of 516.58 g/mol. Its IUPAC name is (1E)-N-(3-morpholin-4-yloxadiazol-3-ium-5-yl)-2-[(4E)-5-oxo-1-phenyl-4-[(E)-3-phenylprop-2-enylidene]imidazol-2-yl]sulfanylethanimidate.
| Compound Name | (1E)-N-(3-morpholin-4-yloxadiazol-3-ium-5-yl)-2-[(4E)-5-oxo-1-phenyl-4-[(E)-3-phenylprop-2-enylidene]imidazol-2-yl]sulfanylethanimidate |
|---|---|
| PubChem CID | 53295000 |
| Molecular Formula | C26H24N6O4S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | (1E)-N-(3-morpholin-4-yloxadiazol-3-ium-5-yl)-2-[(4E)-5-oxo-1-phenyl-4-[(E)-3-phenylprop-2-enylidene]imidazol-2-yl]sulfanylethanimidate |
| SMILES | O=C1/C(=C\C=C\c2ccccc2)N=C(SC/C([O-])=N\c2c[n+](N3CCOCC3)no2)N1c1ccccc1 |
| InChI | InChI=1S/C26H24N6O4S/c33-23(28-24-18-31(29-36-24)30-14-16-35-17-15-30)19-37-26-27-22(13-7-10-20-8-3-1-4-9-20)25(34)32(26)21-11-5-2-6-12-21/h1-13,18H,14-17,19H2/b10-7+,22-13+ |
| InChIKey | NGJBVAQABRTSKO-QNUVFLEMSA-N |
| XLogP | 2.05 |
| TPSA | 110.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|