C12H15BF4N2OSe — CID 53309283
1-[(2-methoxyphenyl)selanylmethyl]-3-methylimidazol-3-ium tetrafluoroborate (PubChem CID 53309283) has the molecular formula C12H15BF4N2OSe and a molecular weight of 369.03 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)selanylmethyl]-3-methylimidazol-3-ium tetrafluoroborate.
| Compound Name | 1-[(2-methoxyphenyl)selanylmethyl]-3-methylimidazol-3-ium tetrafluoroborate |
|---|---|
| PubChem CID | 53309283 |
| Molecular Formula | C12H15BF4N2OSe |
| Molecular Weight | 369.03 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 1-[(2-methoxyphenyl)selanylmethyl]-3-methylimidazol-3-ium tetrafluoroborate |
| SMILES | COc1ccccc1[Se]Cn1cc[n+](C)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C12H15N2OSe.BF4/c1-13-7-8-14(9-13)10-16-12-6-4-3-5-11(12)15-2;2-1(3,4)5/h3-9H,10H2,1-2H3;/q+1;-1 |
| InChIKey | QRACHXYGHXZHON-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.03 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|