C26H22F3NO3 — CID 53309727
ethyl (Z)-3-[2-(naphthalen-2-ylmethyl)-1H-indol-5-yl]-2-(2,2,2-trifluoroethoxy)prop-2-enoate (PubChem CID 53309727) has the molecular formula C26H22F3NO3 and a molecular weight of 453.46 g/mol. Its IUPAC name is ethyl (Z)-3-[2-(naphthalen-2-ylmethyl)-1H-indol-5-yl]-2-(2,2,2-trifluoroethoxy)prop-2-enoate.
| Compound Name | ethyl (Z)-3-[2-(naphthalen-2-ylmethyl)-1H-indol-5-yl]-2-(2,2,2-trifluoroethoxy)prop-2-enoate |
|---|---|
| PubChem CID | 53309727 |
| Molecular Formula | C26H22F3NO3 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | ethyl (Z)-3-[2-(naphthalen-2-ylmethyl)-1H-indol-5-yl]-2-(2,2,2-trifluoroethoxy)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/c1ccc2[nH]c(Cc3ccc4ccccc4c3)cc2c1)OCC(F)(F)F |
| InChI | InChI=1S/C26H22F3NO3/c1-2-32-25(31)24(33-16-26(27,28)29)14-18-8-10-23-21(12-18)15-22(30-23)13-17-7-9-19-5-3-4-6-20(19)11-17/h3-12,14-15,30H,2,13,16H2,1H3/b24-14- |
| InChIKey | AXEZLFNJAJMKMT-OYKKKHCWSA-N |
| XLogP | 6.39 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|