C17H24O2 — CID 53310167
(2R,4S)-2-butoxy-10-methoxytricyclo[5.4.1.04,12]dodeca-1(12),7,9-triene (PubChem CID 53310167) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (2R,4S)-2-butoxy-10-methoxytricyclo[5.4.1.04,12]dodeca-1(12),7,9-triene.
| Compound Name | (2R,4S)-2-butoxy-10-methoxytricyclo[5.4.1.04,12]dodeca-1(12),7,9-triene |
|---|---|
| PubChem CID | 53310167 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (2R,4S)-2-butoxy-10-methoxytricyclo[5.4.1.04,12]dodeca-1(12),7,9-triene |
| SMILES | CCCCO[C@@H]1C[C@@H]2CCC3=CC=C(OC)CC1=C32 |
| InChI | InChI=1S/C17H24O2/c1-3-4-9-19-16-10-13-6-5-12-7-8-14(18-2)11-15(16)17(12)13/h7-8,13,16H,3-6,9-11H2,1-2H3/t13-,16+/m0/s1 |
| InChIKey | FPSKSJXRDYWKIB-XJKSGUPXSA-N |
| XLogP | 4.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|