C15H20O2 — CID 173094034
(1R,4S)-5,10-dimethyl-7,13-dioxatricyclo[10.2.1.04,8]pentadeca-8,10,12(15)-triene (PubChem CID 173094034) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (1R,4S)-5,10-dimethyl-7,13-dioxatricyclo[10.2.1.04,8]pentadeca-8,10,12(15)-triene.
| Compound Name | (1R,4S)-5,10-dimethyl-7,13-dioxatricyclo[10.2.1.04,8]pentadeca-8,10,12(15)-triene |
|---|---|
| PubChem CID | 173094034 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (1R,4S)-5,10-dimethyl-7,13-dioxatricyclo[10.2.1.04,8]pentadeca-8,10,12(15)-triene |
| SMILES | CC1=CC2=C[C@@H](CC[C@@H]3C(=C1)OCC3C)CO2 |
| InChI | InChI=1S/C15H20O2/c1-10-5-13-7-12(9-16-13)3-4-14-11(2)8-17-15(14)6-10/h5-7,11-12,14H,3-4,8-9H2,1-2H3/t11?,12-,14+/m1/s1 |
| InChIKey | YCMKRMZJIXETLU-AOUZGSJDSA-N |
| XLogP | 3.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |