C25H32N4O4 — CID 53317488
benzyl 2-benzyl-2-[[(2S)-1,6-diamino-1-oxohexan-2-yl]carbamoyl]azetidine-1-carboxylate (PubChem CID 53317488) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is benzyl 2-benzyl-2-[[(2S)-1,6-diamino-1-oxohexan-2-yl]carbamoyl]azetidine-1-carboxylate.
| Compound Name | benzyl 2-benzyl-2-[[(2S)-1,6-diamino-1-oxohexan-2-yl]carbamoyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 53317488 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | benzyl 2-benzyl-2-[[(2S)-1,6-diamino-1-oxohexan-2-yl]carbamoyl]azetidine-1-carboxylate |
| SMILES | NCCCC[C@H](NC(=O)C1(Cc2ccccc2)CCN1C(=O)OCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C25H32N4O4/c26-15-8-7-13-21(22(27)30)28-23(31)25(17-19-9-3-1-4-10-19)14-16-29(25)24(32)33-18-20-11-5-2-6-12-20/h1-6,9-12,21H,7-8,13-18,26H2,(H2,27,30)(H,28,31)/t21-,25?/m0/s1 |
| InChIKey | JDVHNHSTBIHGFZ-BWDMCYIDSA-N |
| XLogP | 2.11 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|