C22H26N2O4 — CID 53318301
N-(1-adamantyl)-5,8-dimethoxy-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 53318301) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-(1-adamantyl)-5,8-dimethoxy-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-(1-adamantyl)-5,8-dimethoxy-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 53318301 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N-(1-adamantyl)-5,8-dimethoxy-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | COc1ccc(OC)c2c(=O)c(C(=O)NC34CC5CC(CC(C5)C3)C4)c[nH]c12 |
| InChI | InChI=1S/C22H26N2O4/c1-27-16-3-4-17(28-2)19-18(16)20(25)15(11-23-19)21(26)24-22-8-12-5-13(9-22)7-14(6-12)10-22/h3-4,11-14H,5-10H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | YGJOOZCAQVAHOP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |