C17H13F2NO3S — CID 53337125
3-(3,4-dimethylphenyl)sulfonyl-6,7-difluoro-1H-quinolin-4-one (PubChem CID 53337125) has the molecular formula C17H13F2NO3S and a molecular weight of 349.36 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)sulfonyl-6,7-difluoro-1H-quinolin-4-one.
| Compound Name | 3-(3,4-dimethylphenyl)sulfonyl-6,7-difluoro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 53337125 |
| Molecular Formula | C17H13F2NO3S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 3-(3,4-dimethylphenyl)sulfonyl-6,7-difluoro-1H-quinolin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)c2c[nH]c3cc(F)c(F)cc3c2=O)cc1C |
| InChI | InChI=1S/C17H13F2NO3S/c1-9-3-4-11(5-10(9)2)24(22,23)16-8-20-15-7-14(19)13(18)6-12(15)17(16)21/h3-8H,1-2H3,(H,20,21) |
| InChIKey | VOSZQKPSAQKMFP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |