C16H10ClF2NO3S — CID 53337139
3-(3-chlorophenyl)sulfonyl-6,7-difluoro-1-methylquinolin-4-one (PubChem CID 53337139) has the molecular formula C16H10ClF2NO3S and a molecular weight of 369.78 g/mol. Its IUPAC name is 3-(3-chlorophenyl)sulfonyl-6,7-difluoro-1-methylquinolin-4-one.
| Compound Name | 3-(3-chlorophenyl)sulfonyl-6,7-difluoro-1-methylquinolin-4-one |
|---|---|
| PubChem CID | 53337139 |
| Molecular Formula | C16H10ClF2NO3S |
| Molecular Weight | 369.78 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 3-(3-chlorophenyl)sulfonyl-6,7-difluoro-1-methylquinolin-4-one |
| SMILES | Cn1cc(S(=O)(=O)c2cccc(Cl)c2)c(=O)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C16H10ClF2NO3S/c1-20-8-15(24(22,23)10-4-2-3-9(17)5-10)16(21)11-6-12(18)13(19)7-14(11)20/h2-8H,1H3 |
| InChIKey | QBLAAQSFZXSWHD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.78 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |