C30H44O3Si — CID 53342375
(1R,2R,6R,7S,9R,10R,11R,14S,16R,17S,20R)-20-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-6,10,17-trimethylheptacyclo[11.7.1.02,11.05,10.07,9.014,16.017,21]henicosa-4,13(21)-dien-3-one (PubChem CID 53342375) has the molecular formula C30H44O3Si and a molecular weight of 480.77 g/mol. Its IUPAC name is (1R,2R,6R,7S,9R,10R,11R,14S,16R,17S,20R)-20-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-6,10,17-trimethylheptacyclo[11.7.1.02,11.05,10.07,9.014,16.017,21]henicosa-4,13(21)-dien-3-one.
| Compound Name | (1R,2R,6R,7S,9R,10R,11R,14S,16R,17S,20R)-20-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-6,10,17-trimethylheptacyclo[11.7.1.02,11.05,10.07,9.014,16.017,21]henicosa-4,13(21)-dien-3-one |
|---|---|
| PubChem CID | 53342375 |
| Molecular Formula | C30H44O3Si |
| Molecular Weight | 480.77 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | (1R,2R,6R,7S,9R,10R,11R,14S,16R,17S,20R)-20-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-6,10,17-trimethylheptacyclo[11.7.1.02,11.05,10.07,9.014,16.017,21]henicosa-4,13(21)-dien-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@]2(C)C3=C(C[C@@H]4[C@@H](C(=O)C=C5[C@]4(C)[C@@H]4C[C@@H]4[C@@]5(C)O)[C@H]31)[C@H]1C[C@H]12 |
| InChI | InChI=1S/C30H44O3Si/c1-27(2,3)34(7,8)33-22-9-10-28(4)17-11-15(17)16-12-20-24(25(22)26(16)28)21(31)14-23-29(20,5)18-13-19(18)30(23,6)32/h14-15,17-20,22,24-25,32H,9-13H2,1-8H3/t15-,17-,18-,19+,20-,22-,24+,25-,28+,29-,30-/m1/s1 |
| InChIKey | FNQYCZOCDMYUGU-GPPYSBLNSA-N |
| XLogP | 6.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.77 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|