C17H10F3NO5 — CID 53357309
N-hydroxy-4-[7-hydroxy-4-oxo-2-(trifluoromethyl)chromen-3-yl]benzamide (PubChem CID 53357309) has the molecular formula C17H10F3NO5 and a molecular weight of 365.26 g/mol. Its IUPAC name is N-hydroxy-4-[7-hydroxy-4-oxo-2-(trifluoromethyl)chromen-3-yl]benzamide.
| Compound Name | N-hydroxy-4-[7-hydroxy-4-oxo-2-(trifluoromethyl)chromen-3-yl]benzamide |
|---|---|
| PubChem CID | 53357309 |
| Molecular Formula | C17H10F3NO5 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | N-hydroxy-4-[7-hydroxy-4-oxo-2-(trifluoromethyl)chromen-3-yl]benzamide |
| SMILES | O=C(NO)c1ccc(-c2c(C(F)(F)F)oc3cc(O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C17H10F3NO5/c18-17(19,20)15-13(8-1-3-9(4-2-8)16(24)21-25)14(23)11-6-5-10(22)7-12(11)26-15/h1-7,22,25H,(H,21,24) |
| InChIKey | AXGNDXGXGOBKRI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|