C32H43N2O9P — CID 53359961
1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(6-naphthalen-1-yloxyhexoxy)phosphoryl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrimidine-2,4-dione (PubChem CID 53359961) has the molecular formula C32H43N2O9P and a molecular weight of 630.68 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(6-naphthalen-1-yloxyhexoxy)phosphoryl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(6-naphthalen-1-yloxyhexoxy)phosphoryl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 53359961 |
| Molecular Formula | C32H43N2O9P |
| Molecular Weight | 630.68 g/mol |
| Exact Mass | 630.27 |
| IUPAC Name | 1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(6-naphthalen-1-yloxyhexoxy)phosphoryl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrimidine-2,4-dione |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COP(=O)(OCCCCCCOc1cccc3ccccc13)C(C)(C)C)O[C@H]2n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C32H43N2O9P/c1-31(2,3)44(37,39-20-11-7-6-10-19-38-24-16-12-14-22-13-8-9-15-23(22)24)40-21-25-27-28(43-32(4,5)42-27)29(41-25)34-18-17-26(35)33-30(34)36/h8-9,12-18,25,27-29H,6-7,10-11,19-21H2,1-5H3,(H,33,35,36)/t25-,27-,28-,29-,44?/m1/s1 |
| InChIKey | PVUHYSNKZJFZAP-WZICAWFSSA-N |
| XLogP | 5.77 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.68 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|