C8H8N2O2S2 — CID 53367498
4-methyl-1,1-dioxo-1λ6,2,4-benzothiadiazine-3-thione (PubChem CID 53367498) has the molecular formula C8H8N2O2S2 and a molecular weight of 228.30 g/mol. Its IUPAC name is 4-methyl-1,1-dioxo-1λ6,2,4-benzothiadiazine-3-thione.
| Compound Name | 4-methyl-1,1-dioxo-1λ6,2,4-benzothiadiazine-3-thione |
|---|---|
| PubChem CID | 53367498 |
| Molecular Formula | C8H8N2O2S2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 4-methyl-1,1-dioxo-1λ6,2,4-benzothiadiazine-3-thione |
| SMILES | CN1C(=S)NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C8H8N2O2S2/c1-10-6-4-2-3-5-7(6)14(11,12)9-8(10)13/h2-5H,1H3,(H,9,13) |
| InChIKey | CTABAIIXBJABCV-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|