C23H32O6 — CID 53367521
4-oxo-4-[2-oxo-2-(3-oxo-1,2,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)ethoxy]butanoic acid (PubChem CID 53367521) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is 4-oxo-4-[2-oxo-2-(3-oxo-1,2,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)ethoxy]butanoic acid.
| Compound Name | 4-oxo-4-[2-oxo-2-(3-oxo-1,2,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)ethoxy]butanoic acid |
|---|---|
| PubChem CID | 53367521 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 4-oxo-4-[2-oxo-2-(3-oxo-1,2,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)ethoxy]butanoic acid |
| SMILES | O=C(O)CCC(=O)OCC(=O)C1CCC2C1CCC1C3CCC(=O)CC3CCC12 |
| InChI | InChI=1S/C23H32O6/c24-14-2-4-15-13(11-14)1-3-17-16(15)5-6-19-18(17)7-8-20(19)21(25)12-29-23(28)10-9-22(26)27/h13,15-20H,1-12H2,(H,26,27) |
| InChIKey | LILNLKMFFJJFMF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |