C21H18FN3O2 — CID 53373124
1-[(2-amino-3-fluorophenyl)methyl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinolin-4-one (PubChem CID 53373124) has the molecular formula C21H18FN3O2 and a molecular weight of 363.39 g/mol. Its IUPAC name is 1-[(2-amino-3-fluorophenyl)methyl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinolin-4-one.
| Compound Name | 1-[(2-amino-3-fluorophenyl)methyl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinolin-4-one |
|---|---|
| PubChem CID | 53373124 |
| Molecular Formula | C21H18FN3O2 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 1-[(2-amino-3-fluorophenyl)methyl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinolin-4-one |
| SMILES | Cc1noc(C)c1-c1ccc2c(=O)ccn(Cc3cccc(F)c3N)c2c1 |
| InChI | InChI=1S/C21H18FN3O2/c1-12-20(13(2)27-24-12)14-6-7-16-18(10-14)25(9-8-19(16)26)11-15-4-3-5-17(22)21(15)23/h3-10H,11,23H2,1-2H3 |
| InChIKey | HMOYMFZWJWSPHB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|