C30H40N4O2 — CID 53373291
[1-(7,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-8-yl)-2-pyridin-3-ylpropan-2-yl] 2-amino-4-methylpentanoate (PubChem CID 53373291) has the molecular formula C30H40N4O2 and a molecular weight of 488.68 g/mol. Its IUPAC name is [1-(7,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-8-yl)-2-pyridin-3-ylpropan-2-yl] 2-amino-4-methylpentanoate.
| Compound Name | [1-(7,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-8-yl)-2-pyridin-3-ylpropan-2-yl] 2-amino-4-methylpentanoate |
|---|---|
| PubChem CID | 53373291 |
| Molecular Formula | C30H40N4O2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | [1-(7,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-8-yl)-2-pyridin-3-ylpropan-2-yl] 2-amino-4-methylpentanoate |
| SMILES | Cc1cc(CC(C)(OC(=O)C(N)CC(C)C)c2cccnc2)c2c(c1)c1c(n2C)CCN2CCCC12 |
| InChI | InChI=1S/C30H40N4O2/c1-19(2)14-24(31)29(35)36-30(4,22-8-6-11-32-18-22)17-21-15-20(3)16-23-27-25(33(5)28(21)23)10-13-34-12-7-9-26(27)34/h6,8,11,15-16,18-19,24,26H,7,9-10,12-14,17,31H2,1-5H3 |
| InChIKey | RMWYCEZAHPEWOO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|