C25H33N3O2 — CID 71470740
[1-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-2-pyridin-3-ylpropan-2-yl] 2-methylpropanoate (PubChem CID 71470740) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is [1-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-2-pyridin-3-ylpropan-2-yl] 2-methylpropanoate.
| Compound Name | [1-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-2-pyridin-3-ylpropan-2-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 71470740 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | [1-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-2-pyridin-3-ylpropan-2-yl] 2-methylpropanoate |
| SMILES | Cc1ccc2c(c1)C1CN(C)CCC1N2CC(C)(OC(=O)C(C)C)c1cccnc1 |
| InChI | InChI=1S/C25H33N3O2/c1-17(2)24(29)30-25(4,19-7-6-11-26-14-19)16-28-22-9-8-18(3)13-20(22)21-15-27(5)12-10-23(21)28/h6-9,11,13-14,17,21,23H,10,12,15-16H2,1-5H3 |
| InChIKey | YTCWZCKFTUFPBQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |