About CID 53375863
CID 53375863 (PubChem CID 53375863) has the molecular formula C19H20FeOS+2
and a molecular weight of 352.28 g/mol.
Molecular Properties
| Compound Name | CID 53375863 |
| PubChem CID | 53375863 |
| Molecular Formula | C19H20FeOS+2 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c([S@](=O)[C]2[CH][CH][CH][CH]2)c(C)c1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C14H15OS.C5H5.Fe/c1-10-8-11(2)14(12(3)9-10)16(15)13-6-4-5-7-13;1-2-4-5-3-1;/h4-9H,1-3H3;1-5H;/q;;+2/t16-;;/m1../s1 |
| InChIKey | AIIHTIOLUVPMLP-GGMCWBHBSA-N |
| XLogP | 4.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 53375863 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 53375863?
The IUPAC name of CID 53375863 (CID 53375863) is not available.
What is the SMILES notation for CID 53375863?
The canonical SMILES for CID 53375863 is Cc1cc(C)c([S@](=O)[C]2[CH][CH][CH][CH]2)c(C)c1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 53375863?
The InChIKey is AIIHTIOLUVPMLP-GGMCWBHBSA-N. The full InChI is InChI=1S/C14H15OS.C5H5.Fe/c1-10-8-11(2)14(12(3)9-10)16(15)13-6-4-5-7-13;1-2-4-5-3-1;/h4-9H,1-3H3;1-5H;/q;;+2/t16-;;/m1../s1.
What are the key properties of CID 53375863?
CID 53375863 has a molecular weight of 352.28 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 53375863 is sourced from PubChem (CID 53375863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).