C13H15NO — CID 53381464
2,2,8-trimethyl-1H-quinoline-3-carbaldehyde (PubChem CID 53381464) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 2,2,8-trimethyl-1H-quinoline-3-carbaldehyde.
| Compound Name | 2,2,8-trimethyl-1H-quinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 53381464 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 2,2,8-trimethyl-1H-quinoline-3-carbaldehyde |
| SMILES | Cc1cccc2c1NC(C)(C)C(C=O)=C2 |
| InChI | InChI=1S/C13H15NO/c1-9-5-4-6-10-7-11(8-15)13(2,3)14-12(9)10/h4-8,14H,1-3H3 |
| InChIKey | FYRLQOAPKWYVRQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|