C26H39N3O4S — CID 53382469
8-[(2-methylpropan-2-yl)oxycarbonylamino]octyl (E)-2-cyano-3-(5-piperidin-1-ylthiophen-2-yl)prop-2-enoate (PubChem CID 53382469) has the molecular formula C26H39N3O4S and a molecular weight of 489.68 g/mol. Its IUPAC name is 8-[(2-methylpropan-2-yl)oxycarbonylamino]octyl (E)-2-cyano-3-(5-piperidin-1-ylthiophen-2-yl)prop-2-enoate.
| Compound Name | 8-[(2-methylpropan-2-yl)oxycarbonylamino]octyl (E)-2-cyano-3-(5-piperidin-1-ylthiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 53382469 |
| Molecular Formula | C26H39N3O4S |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | 8-[(2-methylpropan-2-yl)oxycarbonylamino]octyl (E)-2-cyano-3-(5-piperidin-1-ylthiophen-2-yl)prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCCOC(=O)/C(C#N)=C/c1ccc(N2CCCCC2)s1 |
| InChI | InChI=1S/C26H39N3O4S/c1-26(2,3)33-25(31)28-15-9-6-4-5-7-12-18-32-24(30)21(20-27)19-22-13-14-23(34-22)29-16-10-8-11-17-29/h13-14,19H,4-12,15-18H2,1-3H3,(H,28,31)/b21-19+ |
| InChIKey | OQBQVOVRAOKRJF-XUTLUUPISA-N |
| XLogP | 6.05 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|