C18H18N2O4S2 — CID 53387968
3-[(E)-4-(2,4-dioxo-1-thia-3-azaspiro[4.4]non-7-en-3-yl)but-2-enyl]-1-thia-3-azaspiro[4.4]non-7-ene-2,4-dione (PubChem CID 53387968) has the molecular formula C18H18N2O4S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 3-[(E)-4-(2,4-dioxo-1-thia-3-azaspiro[4.4]non-7-en-3-yl)but-2-enyl]-1-thia-3-azaspiro[4.4]non-7-ene-2,4-dione.
| Compound Name | 3-[(E)-4-(2,4-dioxo-1-thia-3-azaspiro[4.4]non-7-en-3-yl)but-2-enyl]-1-thia-3-azaspiro[4.4]non-7-ene-2,4-dione |
|---|---|
| PubChem CID | 53387968 |
| Molecular Formula | C18H18N2O4S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 3-[(E)-4-(2,4-dioxo-1-thia-3-azaspiro[4.4]non-7-en-3-yl)but-2-enyl]-1-thia-3-azaspiro[4.4]non-7-ene-2,4-dione |
| SMILES | O=C1SC2(CC=CC2)C(=O)N1C/C=C/CN1C(=O)SC2(CC=CC2)C1=O |
| InChI | InChI=1S/C18H18N2O4S2/c21-13-17(7-1-2-8-17)25-15(23)19(13)11-5-6-12-20-14(22)18(26-16(20)24)9-3-4-10-18/h1-6H,7-12H2/b6-5+ |
| InChIKey | HJGZSGNCDVSCRH-AATRIKPKSA-N |
| XLogP | 3.11 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|