C10H11NO2S — CID 53386505
3-prop-2-enyl-1-thia-3-azaspiro[4.4]non-7-ene-2,4-dione (PubChem CID 53386505) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 3-prop-2-enyl-1-thia-3-azaspiro[4.4]non-7-ene-2,4-dione.
| Compound Name | 3-prop-2-enyl-1-thia-3-azaspiro[4.4]non-7-ene-2,4-dione |
|---|---|
| PubChem CID | 53386505 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 3-prop-2-enyl-1-thia-3-azaspiro[4.4]non-7-ene-2,4-dione |
| SMILES | C=CCN1C(=O)SC2(CC=CC2)C1=O |
| InChI | InChI=1S/C10H11NO2S/c1-2-7-11-8(12)10(14-9(11)13)5-3-4-6-10/h2-4H,1,5-7H2 |
| InChIKey | WOUUCCFABMTQNP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|