C5H2Cl2O2 — CID 53428246
5,5-dichlorocyclopent-3-ene-1,2-dione (PubChem CID 53428246) has the molecular formula C5H2Cl2O2 and a molecular weight of 164.97 g/mol. Its IUPAC name is 5,5-dichlorocyclopent-3-ene-1,2-dione.
| Compound Name | 5,5-dichlorocyclopent-3-ene-1,2-dione |
|---|---|
| PubChem CID | 53428246 |
| Molecular Formula | C5H2Cl2O2 |
| Molecular Weight | 164.97 g/mol |
| Exact Mass | 163.94 |
| IUPAC Name | 5,5-dichlorocyclopent-3-ene-1,2-dione |
| SMILES | O=C1C=CC(Cl)(Cl)C1=O |
| InChI | InChI=1S/C5H2Cl2O2/c6-5(7)2-1-3(8)4(5)9/h1-2H |
| InChIKey | OEBRZZKMGWHSGW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.97 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|