C11H2Cl6O2 — CID 11025279
(1S,8R)-1,8,9,10,11,11-hexachlorotricyclo[6.2.1.02,7]undeca-2(7),4,9-triene-3,6-dione (PubChem CID 11025279) has the molecular formula C11H2Cl6O2 and a molecular weight of 378.85 g/mol. Its IUPAC name is (1S,8R)-1,8,9,10,11,11-hexachlorotricyclo[6.2.1.02,7]undeca-2(7),4,9-triene-3,6-dione.
| Compound Name | (1S,8R)-1,8,9,10,11,11-hexachlorotricyclo[6.2.1.02,7]undeca-2(7),4,9-triene-3,6-dione |
|---|---|
| PubChem CID | 11025279 |
| Molecular Formula | C11H2Cl6O2 |
| Molecular Weight | 378.85 g/mol |
| Exact Mass | 375.82 |
| IUPAC Name | (1S,8R)-1,8,9,10,11,11-hexachlorotricyclo[6.2.1.02,7]undeca-2(7),4,9-triene-3,6-dione |
| SMILES | O=C1C=CC(=O)C2=C1[C@]1(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C11H2Cl6O2/c12-7-8(13)10(15)6-4(19)2-1-3(18)5(6)9(7,14)11(10,16)17/h1-2H/t9-,10+ |
| InChIKey | ZGKZODKOAMGYRM-AOOOYVTPSA-N |
| XLogP | 3.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.85 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|