C8H2BrCl5O3 — CID 10834985
(1R,2R,6S,7S)-10-bromo-1,7,8,9,10-pentachloro-3,5-dioxatricyclo[5.2.1.02,6]dec-8-en-4-one (PubChem CID 10834985) has the molecular formula C8H2BrCl5O3 and a molecular weight of 403.27 g/mol. Its IUPAC name is (1R,2R,6S,7S)-10-bromo-1,7,8,9,10-pentachloro-3,5-dioxatricyclo[5.2.1.02,6]dec-8-en-4-one.
| Compound Name | (1R,2R,6S,7S)-10-bromo-1,7,8,9,10-pentachloro-3,5-dioxatricyclo[5.2.1.02,6]dec-8-en-4-one |
|---|---|
| PubChem CID | 10834985 |
| Molecular Formula | C8H2BrCl5O3 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 399.76 |
| IUPAC Name | (1R,2R,6S,7S)-10-bromo-1,7,8,9,10-pentachloro-3,5-dioxatricyclo[5.2.1.02,6]dec-8-en-4-one |
| SMILES | O=C1O[C@@H]2[C@H](O1)[C@]1(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C1(Cl)Br |
| InChI | InChI=1S/C8H2BrCl5O3/c9-8(14)6(12)1(10)2(11)7(8,13)4-3(6)16-5(15)17-4/h3-4H/t3-,4+,6+,7-,8? |
| InChIKey | QJOHJBDDUHNFMO-HLEUKRPUSA-N |
| XLogP | 3.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|