C7H2Cl6O3 — CID 124921806
(1S,2S,4S,6S)-1,2,4,6,7,8-hexachloro-2-hydroxy-3-oxabicyclo[4.2.0]oct-7-en-5-one (PubChem CID 124921806) has the molecular formula C7H2Cl6O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is (1S,2S,4S,6S)-1,2,4,6,7,8-hexachloro-2-hydroxy-3-oxabicyclo[4.2.0]oct-7-en-5-one.
| Compound Name | (1S,2S,4S,6S)-1,2,4,6,7,8-hexachloro-2-hydroxy-3-oxabicyclo[4.2.0]oct-7-en-5-one |
|---|---|
| PubChem CID | 124921806 |
| Molecular Formula | C7H2Cl6O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 343.81 |
| IUPAC Name | (1S,2S,4S,6S)-1,2,4,6,7,8-hexachloro-2-hydroxy-3-oxabicyclo[4.2.0]oct-7-en-5-one |
| SMILES | O=C1[C@H](Cl)O[C@](O)(Cl)[C@]2(Cl)C(Cl)=C(Cl)[C@@]12Cl |
| InChI | InChI=1S/C7H2Cl6O3/c8-1-2(9)6(12)5(1,11)3(14)4(10)16-7(6,13)15/h4,15H/t4-,5-,6+,7+/m1/s1 |
| InChIKey | BZGQLKJNISWUDN-JWXFUTCRSA-N |
| XLogP | 2.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|