C18Cl12F6O6S2 — CID 56956393
[(1S,5R,8S,12R)-1,5,6,7,8,12,13,14,15,15,16,16-dodecachloro-10-(trifluoromethylsulfonyloxy)-3-pentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2,4(9),6,10,13-pentaenyl] trifluoromethanesulfonate (PubChem CID 56956393) has the molecular formula C18Cl12F6O6S2 and a molecular weight of 915.75 g/mol. Its IUPAC name is [(1S,5R,8S,12R)-1,5,6,7,8,12,13,14,15,15,16,16-dodecachloro-10-(trifluoromethylsulfonyloxy)-3-pentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2,4(9),6,10,13-pentaenyl] trifluoromethanesulfonate.
| Compound Name | [(1S,5R,8S,12R)-1,5,6,7,8,12,13,14,15,15,16,16-dodecachloro-10-(trifluoromethylsulfonyloxy)-3-pentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2,4(9),6,10,13-pentaenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 56956393 |
| Molecular Formula | C18Cl12F6O6S2 |
| Molecular Weight | 915.75 g/mol |
| Exact Mass | 909.53 |
| IUPAC Name | [(1S,5R,8S,12R)-1,5,6,7,8,12,13,14,15,15,16,16-dodecachloro-10-(trifluoromethylsulfonyloxy)-3-pentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2,4(9),6,10,13-pentaenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1c2c(c(OS(=O)(=O)C(F)(F)F)c3c1[C@@]1(Cl)C(Cl)=C(Cl)[C@]3(Cl)C1(Cl)Cl)[C@@]1(Cl)C(Cl)=C(Cl)[C@]2(Cl)C1(Cl)Cl)C(F)(F)F |
| InChI | InChI=1S/C18Cl12F6O6S2/c19-7-8(20)12(24)2-1(11(7,23)15(12,27)28)5(41-43(37,38)17(31,32)33)3-4(6(2)42-44(39,40)18(34,35)36)14(26)10(22)9(21)13(3,25)16(14,29)30/t11-,12+,13+,14- |
| InChIKey | UCOCSIHUKPANRQ-LVEBTZEWSA-N |
| XLogP | 9.66 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.75 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|