About N',N'-dicyanodecanediamide
N',N'-dicyanodecanediamide (PubChem CID 53439470) has the molecular formula C12H18N4O2
and a molecular weight of 250.30 g/mol. Its IUPAC name is N',N'-dicyanodecanediamide.
Molecular Properties
| Compound Name | N',N'-dicyanodecanediamide |
| PubChem CID | 53439470 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N',N'-dicyanodecanediamide |
| SMILES | N#CN(C#N)C(=O)CCCCCCCCC(N)=O |
| InChI | InChI=1S/C12H18N4O2/c13-9-16(10-14)12(18)8-6-4-2-1-3-5-7-11(15)17/h1-8H2,(H2,15,17) |
| InChIKey | TYVJFVNRBQZVJJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze N',N'-dicyanodecanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-dicyanodecanediamide?
The IUPAC name of N',N'-dicyanodecanediamide (CID 53439470) is N',N'-dicyanodecanediamide.
What is the SMILES notation for N',N'-dicyanodecanediamide?
The canonical SMILES for N',N'-dicyanodecanediamide is N#CN(C#N)C(=O)CCCCCCCCC(N)=O.
What is the InChIKey of N',N'-dicyanodecanediamide?
The InChIKey is TYVJFVNRBQZVJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O2/c13-9-16(10-14)12(18)8-6-4-2-1-3-5-7-11(15)17/h1-8H2,(H2,15,17).
What are the key properties of N',N'-dicyanodecanediamide?
N',N'-dicyanodecanediamide has a molecular weight of 250.30 g/mol, XLogP of 1.38, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-dicyanodecanediamide is sourced from PubChem (CID 53439470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).