C35H43F3O6 — CID 53466989
[(2E,4R,5R,6E,8E,12E)-13-(6-methoxy-3,5-dimethyl-4-oxopyran-2-yl)-3,5,7,11-tetramethyltrideca-2,6,8,12-tetraen-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 53466989) has the molecular formula C35H43F3O6 and a molecular weight of 616.72 g/mol. Its IUPAC name is [(2E,4R,5R,6E,8E,12E)-13-(6-methoxy-3,5-dimethyl-4-oxopyran-2-yl)-3,5,7,11-tetramethyltrideca-2,6,8,12-tetraen-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2E,4R,5R,6E,8E,12E)-13-(6-methoxy-3,5-dimethyl-4-oxopyran-2-yl)-3,5,7,11-tetramethyltrideca-2,6,8,12-tetraen-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 53466989 |
| Molecular Formula | C35H43F3O6 |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | [(2E,4R,5R,6E,8E,12E)-13-(6-methoxy-3,5-dimethyl-4-oxopyran-2-yl)-3,5,7,11-tetramethyltrideca-2,6,8,12-tetraen-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C/C=C(\C)[C@H](OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)[C@H](C)/C=C(C)/C=C/CC(C)/C=C/c1oc(OC)c(C)c(=O)c1C |
| InChI | InChI=1S/C35H43F3O6/c1-10-24(4)31(44-33(40)34(42-9,35(36,37)38)28-17-12-11-13-18-28)25(5)21-23(3)16-14-15-22(2)19-20-29-26(6)30(39)27(7)32(41-8)43-29/h10-14,16-22,25,31H,15H2,1-9H3/b16-14+,20-19+,23-21+,24-10+/t22?,25-,31+,34-/m1/s1 |
| InChIKey | DQNQTMSJRVBNJX-BJFNUWJFSA-N |
| XLogP | 8.43 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|