C32H41F3O7 — CID 11707001
[(2E,4R,5R,6E,8E,12R)-12-hydroxy-13-(5-hydroxy-3,5-dimethyl-4-oxofuran-2-yl)-3,5,9-trimethyltrideca-2,6,8-trien-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 11707001) has the molecular formula C32H41F3O7 and a molecular weight of 594.67 g/mol. Its IUPAC name is [(2E,4R,5R,6E,8E,12R)-12-hydroxy-13-(5-hydroxy-3,5-dimethyl-4-oxofuran-2-yl)-3,5,9-trimethyltrideca-2,6,8-trien-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2E,4R,5R,6E,8E,12R)-12-hydroxy-13-(5-hydroxy-3,5-dimethyl-4-oxofuran-2-yl)-3,5,9-trimethyltrideca-2,6,8-trien-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 11707001 |
| Molecular Formula | C32H41F3O7 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | [(2E,4R,5R,6E,8E,12R)-12-hydroxy-13-(5-hydroxy-3,5-dimethyl-4-oxofuran-2-yl)-3,5,9-trimethyltrideca-2,6,8-trien-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C/C=C(\C)[C@H](OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)[C@H](C)/C=C/C=C(\C)CC[C@@H](O)CC1=C(C)C(=O)C(C)(O)O1 |
| InChI | InChI=1S/C32H41F3O7/c1-8-21(3)27(41-29(38)31(40-7,32(33,34)35)24-15-10-9-11-16-24)22(4)14-12-13-20(2)17-18-25(36)19-26-23(5)28(37)30(6,39)42-26/h8-16,22,25,27,36,39H,17-19H2,1-7H3/b14-12+,20-13+,21-8+/t22-,25-,27+,30?,31-/m1/s1 |
| InChIKey | PTLLAWWXEYQHQQ-IOKJBVMPSA-N |
| XLogP | 6.22 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|