C26H34N2O2 — CID 53467884
tert-butyl 1-but-3-enyl-3,4-dipropylpyrido[3,4-b]indole-9-carboxylate (PubChem CID 53467884) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is tert-butyl 1-but-3-enyl-3,4-dipropylpyrido[3,4-b]indole-9-carboxylate.
| Compound Name | tert-butyl 1-but-3-enyl-3,4-dipropylpyrido[3,4-b]indole-9-carboxylate |
|---|---|
| PubChem CID | 53467884 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | tert-butyl 1-but-3-enyl-3,4-dipropylpyrido[3,4-b]indole-9-carboxylate |
| SMILES | C=CCCc1nc(CCC)c(CCC)c2c3ccccc3n(C(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C26H34N2O2/c1-7-10-16-21-24-23(18(13-8-2)20(27-21)14-9-3)19-15-11-12-17-22(19)28(24)25(29)30-26(4,5)6/h7,11-12,15,17H,1,8-10,13-14,16H2,2-6H3 |
| InChIKey | DBCATDPRIJFKCN-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|