C16H13BrF2N2OS — CID 53475246
2-(2-bromo-5,5-difluoro-3-hexyl-4-oxocyclopenta[b]thiophen-6-ylidene)propanedinitrile (PubChem CID 53475246) has the molecular formula C16H13BrF2N2OS and a molecular weight of 399.26 g/mol. Its IUPAC name is 2-(2-bromo-5,5-difluoro-3-hexyl-4-oxocyclopenta[b]thiophen-6-ylidene)propanedinitrile.
| Compound Name | 2-(2-bromo-5,5-difluoro-3-hexyl-4-oxocyclopenta[b]thiophen-6-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 53475246 |
| Molecular Formula | C16H13BrF2N2OS |
| Molecular Weight | 399.26 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 2-(2-bromo-5,5-difluoro-3-hexyl-4-oxocyclopenta[b]thiophen-6-ylidene)propanedinitrile |
| SMILES | CCCCCCc1c(Br)sc2c1C(=O)C(F)(F)C2=C(C#N)C#N |
| InChI | InChI=1S/C16H13BrF2N2OS/c1-2-3-4-5-6-10-11-13(23-15(10)17)12(9(7-20)8-21)16(18,19)14(11)22/h2-6H2,1H3 |
| InChIKey | HKOIAHHASZSUIF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.26 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|